C15H15ClN2S — CID 114865036
N-[(4-chloro-2-pyridin-4-ylsulfanylphenyl)methyl]cyclopropanamine (PubChem CID 114865036) has the molecular formula C15H15ClN2S and a molecular weight of 290.82 g/mol. Its IUPAC name is N-[(4-chloro-2-pyridin-4-ylsulfanylphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(4-chloro-2-pyridin-4-ylsulfanylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114865036 |
| Molecular Formula | C15H15ClN2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-[(4-chloro-2-pyridin-4-ylsulfanylphenyl)methyl]cyclopropanamine |
| SMILES | Clc1ccc(CNC2CC2)c(Sc2ccncc2)c1 |
| InChI | InChI=1S/C15H15ClN2S/c16-12-2-1-11(10-18-13-3-4-13)15(9-12)19-14-5-7-17-8-6-14/h1-2,5-9,13,18H,3-4,10H2 |
| InChIKey | YNFZOGUAOPSSHJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |