C17H15F2N3O4S — CID 55581588
2-fluoro-5-[[(4-fluorobenzoyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 55581588) has the molecular formula C17H15F2N3O4S and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-fluoro-5-[[(4-fluorobenzoyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2-fluoro-5-[[(4-fluorobenzoyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 55581588 |
| Molecular Formula | C17H15F2N3O4S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-fluoro-5-[[(4-fluorobenzoyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)NNC(=O)c2ccc(F)cc2)ccc1F |
| InChI | InChI=1S/C17H15F2N3O4S/c1-2-9-20-27(25,26)15-10-12(5-8-14(15)19)17(24)22-21-16(23)11-3-6-13(18)7-4-11/h2-8,10,20H,1,9H2,(H,21,23)(H,22,24) |
| InChIKey | GIOWDJZJWQSUGN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|