C20H22ClFN2O4S — CID 30857214
4-chloro-N-[4-(4-fluorophenoxy)butyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 30857214) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-fluorophenoxy)butyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[4-(4-fluorophenoxy)butyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 30857214 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-chloro-N-[4-(4-fluorophenoxy)butyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)NCCCCOc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C20H22ClFN2O4S/c1-2-11-24-29(26,27)19-14-15(5-10-18(19)21)20(25)23-12-3-4-13-28-17-8-6-16(22)7-9-17/h2,5-10,14,24H,1,3-4,11-13H2,(H,23,25) |
| InChIKey | DSHIKRAWTFYHSW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|