C16H13Cl2FN2O3S — CID 9165964
4-chloro-N-(3-chloro-4-fluorophenyl)-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 9165964) has the molecular formula C16H13Cl2FN2O3S and a molecular weight of 403.26 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-4-fluorophenyl)-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(3-chloro-4-fluorophenyl)-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9165964 |
| Molecular Formula | C16H13Cl2FN2O3S |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4-chloro-N-(3-chloro-4-fluorophenyl)-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O3S/c1-2-7-20-25(23,24)15-8-10(3-5-12(15)17)16(22)21-11-4-6-14(19)13(18)9-11/h2-6,8-9,20H,1,7H2,(H,21,22) |
| InChIKey | OBIDBVROVDBUIR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|