C18H17F3N2O2S — CID 46538000
N-(2-acetylphenyl)-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]acetamide (PubChem CID 46538000) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]acetamide |
|---|---|
| PubChem CID | 46538000 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(2-acetylphenyl)-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]acetamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CNc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2S/c1-12(24)13-6-2-3-7-14(13)23-17(25)10-22-15-8-4-5-9-16(15)26-11-18(19,20)21/h2-9,22H,10-11H2,1H3,(H,23,25) |
| InChIKey | XZAVUGMGKYKBPS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |