C12H14ClF3N2O2S — CID 111453698
1-[5-chloro-2-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 111453698) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 1-[5-chloro-2-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[5-chloro-2-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 111453698 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-[5-chloro-2-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)Nc1cc(Cl)ccc1SCC(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N2O2S/c13-8-2-3-10(21-7-12(14,15)16)9(6-8)18-11(20)17-4-1-5-19/h2-3,6,19H,1,4-5,7H2,(H2,17,18,20) |
| InChIKey | CBXLGWSLHVPGIH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|