C16H17ClNO2PS — CID 89046771
2-chloro-N-[2-[methoxyphosphanyl(phenyl)methyl]sulfanylphenyl]acetamide (PubChem CID 89046771) has the molecular formula C16H17ClNO2PS and a molecular weight of 353.81 g/mol. Its IUPAC name is 2-chloro-N-[2-[methoxyphosphanyl(phenyl)methyl]sulfanylphenyl]acetamide.
| Compound Name | 2-chloro-N-[2-[methoxyphosphanyl(phenyl)methyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 89046771 |
| Molecular Formula | C16H17ClNO2PS |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-chloro-N-[2-[methoxyphosphanyl(phenyl)methyl]sulfanylphenyl]acetamide |
| SMILES | COPC(Sc1ccccc1NC(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C16H17ClNO2PS/c1-20-21-16(12-7-3-2-4-8-12)22-14-10-6-5-9-13(14)18-15(19)11-17/h2-10,16,21H,11H2,1H3,(H,18,19) |
| InChIKey | QOMNKNKVQGBFSP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|