C12H12ClIN2O4 — CID 134917538
methyl 3-[2-[(2-chloroacetyl)amino]anilino]-2-iodo-3-oxopropanoate (PubChem CID 134917538) has the molecular formula C12H12ClIN2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is methyl 3-[2-[(2-chloroacetyl)amino]anilino]-2-iodo-3-oxopropanoate.
| Compound Name | methyl 3-[2-[(2-chloroacetyl)amino]anilino]-2-iodo-3-oxopropanoate |
|---|---|
| PubChem CID | 134917538 |
| Molecular Formula | C12H12ClIN2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | methyl 3-[2-[(2-chloroacetyl)amino]anilino]-2-iodo-3-oxopropanoate |
| SMILES | COC(=O)C(I)C(=O)Nc1ccccc1NC(=O)CCl |
| InChI | InChI=1S/C12H12ClIN2O4/c1-20-12(19)10(14)11(18)16-8-5-3-2-4-7(8)15-9(17)6-13/h2-5,10H,6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | JEAAYLJCEOYRAQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|