C36H38N2O4S — CID 22010595
ethyl 6-[2-[2-(methylcarbamoyl)-5-[[2-(4-methylphenyl)benzoyl]amino]phenyl]phenyl]sulfanylhexanoate (PubChem CID 22010595) has the molecular formula C36H38N2O4S and a molecular weight of 594.78 g/mol. Its IUPAC name is ethyl 6-[2-[2-(methylcarbamoyl)-5-[[2-(4-methylphenyl)benzoyl]amino]phenyl]phenyl]sulfanylhexanoate.
| Compound Name | ethyl 6-[2-[2-(methylcarbamoyl)-5-[[2-(4-methylphenyl)benzoyl]amino]phenyl]phenyl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22010595 |
| Molecular Formula | C36H38N2O4S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | ethyl 6-[2-[2-(methylcarbamoyl)-5-[[2-(4-methylphenyl)benzoyl]amino]phenyl]phenyl]sulfanylhexanoate |
| SMILES | CCOC(=O)CCCCCSc1ccccc1-c1cc(NC(=O)c2ccccc2-c2ccc(C)cc2)ccc1C(=O)NC |
| InChI | InChI=1S/C36H38N2O4S/c1-4-42-34(39)16-6-5-11-23-43-33-15-10-9-13-29(33)32-24-27(21-22-31(32)35(40)37-3)38-36(41)30-14-8-7-12-28(30)26-19-17-25(2)18-20-26/h7-10,12-15,17-22,24H,4-6,11,16,23H2,1-3H3,(H,37,40)(H,38,41) |
| InChIKey | ICTYQKNAZSPDOP-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|