C37H40N2O6 — CID 22010990
ethyl 6-[2-[[3-methoxy-4-[(2-phenylbenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate (PubChem CID 22010990) has the molecular formula C37H40N2O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is ethyl 6-[2-[[3-methoxy-4-[(2-phenylbenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[[3-methoxy-4-[(2-phenylbenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate |
|---|---|
| PubChem CID | 22010990 |
| Molecular Formula | C37H40N2O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | ethyl 6-[2-[[3-methoxy-4-[(2-phenylbenzoyl)amino]benzoyl]-methylamino]-5-methylphenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc(C)ccc1N(C)C(=O)c1ccc(NC(=O)c2ccccc2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C37H40N2O6/c1-5-44-35(40)18-10-7-13-23-45-34-24-26(2)19-22-32(34)39(3)37(42)28-20-21-31(33(25-28)43-4)38-36(41)30-17-12-11-16-29(30)27-14-8-6-9-15-27/h6,8-9,11-12,14-17,19-22,24-25H,5,7,10,13,18,23H2,1-4H3,(H,38,41) |
| InChIKey | MPACCUHGMOMHNM-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|