C33H43N5O6 — CID 70058200
4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[4-(dimethylcarbamoylamino)butoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide (PubChem CID 70058200) has the molecular formula C33H43N5O6 and a molecular weight of 605.74 g/mol. Its IUPAC name is 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[4-(dimethylcarbamoylamino)butoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[4-(dimethylcarbamoylamino)butoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 70058200 |
| Molecular Formula | C33H43N5O6 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | 4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[4-(dimethylcarbamoylamino)butoxy]-4-methylphenyl]-3-methoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCNC(=O)N(C)C)ccc1NC(=O)c1ccccc1OCCCN |
| InChI | InChI=1S/C33H43N5O6/c1-23-13-16-27(30(21-23)44-19-9-8-18-35-33(41)37(2)3)38(4)32(40)24-14-15-26(29(22-24)42-5)36-31(39)25-11-6-7-12-28(25)43-20-10-17-34/h6-7,11-16,21-22H,8-10,17-20,34H2,1-5H3,(H,35,41)(H,36,39) |
| InChIKey | DKHISJNVBZMIMB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|