C37H47N3O8 — CID 18791391
tert-butyl N-[3-[2-[[2-methoxy-4-[methyl-[4-methyl-2-(6-oxohexoxy)phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]propyl]carbamate (PubChem CID 18791391) has the molecular formula C37H47N3O8 and a molecular weight of 661.80 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[[2-methoxy-4-[methyl-[4-methyl-2-(6-oxohexoxy)phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[[2-methoxy-4-[methyl-[4-methyl-2-(6-oxohexoxy)phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 18791391 |
| Molecular Formula | C37H47N3O8 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | tert-butyl N-[3-[2-[[2-methoxy-4-[methyl-[4-methyl-2-(6-oxohexoxy)phenyl]carbamoyl]phenyl]carbamoyl]phenoxy]propyl]carbamate |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCCC=O)ccc1NC(=O)c1ccccc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H47N3O8/c1-26-16-19-30(33(24-26)47-22-12-8-7-11-21-41)40(5)35(43)27-17-18-29(32(25-27)45-6)39-34(42)28-14-9-10-15-31(28)46-23-13-20-38-36(44)48-37(2,3)4/h9-10,14-19,21,24-25H,7-8,11-13,20,22-23H2,1-6H3,(H,38,44)(H,39,42) |
| InChIKey | ZDZNAEXUCKHKLL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|