C28H23ClN2O2 — CID 22010622
N-[4-[(4-chlorophenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 22010622) has the molecular formula C28H23ClN2O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[(4-chlorophenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 22010622 |
| Molecular Formula | C28H23ClN2O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[4-[(4-chlorophenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N(C)c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H23ClN2O2/c1-19-7-9-20(10-8-19)25-5-3-4-6-26(25)27(32)30-23-15-11-21(12-16-23)28(33)31(2)24-17-13-22(29)14-18-24/h3-18H,1-2H3,(H,30,32) |
| InChIKey | QOHXFWYGWLAPGP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |