C29H26N2O3 — CID 22010705
N-[4-[(2-hydroxy-5-methylphenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 22010705) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[4-[(2-hydroxy-5-methylphenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[(2-hydroxy-5-methylphenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 22010705 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4-[(2-hydroxy-5-methylphenyl)-methylcarbamoyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N(C)c3cc(C)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O3/c1-19-8-11-21(12-9-19)24-6-4-5-7-25(24)28(33)30-23-15-13-22(14-16-23)29(34)31(3)26-18-20(2)10-17-27(26)32/h4-18,32H,1-3H3,(H,30,33) |
| InChIKey | GHRRJBOHFNRZHP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |