C28H24N2O3 — CID 67698934
N-[2-[(2-hydroxyphenyl)-methylcarbamoyl]phenyl]-5-methyl-2-phenylbenzamide (PubChem CID 67698934) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[2-[(2-hydroxyphenyl)-methylcarbamoyl]phenyl]-5-methyl-2-phenylbenzamide.
| Compound Name | N-[2-[(2-hydroxyphenyl)-methylcarbamoyl]phenyl]-5-methyl-2-phenylbenzamide |
|---|---|
| PubChem CID | 67698934 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[2-[(2-hydroxyphenyl)-methylcarbamoyl]phenyl]-5-methyl-2-phenylbenzamide |
| SMILES | Cc1ccc(-c2ccccc2)c(C(=O)Nc2ccccc2C(=O)N(C)c2ccccc2O)c1 |
| InChI | InChI=1S/C28H24N2O3/c1-19-16-17-21(20-10-4-3-5-11-20)23(18-19)27(32)29-24-13-7-6-12-22(24)28(33)30(2)25-14-8-9-15-26(25)31/h3-18,31H,1-2H3,(H,29,32) |
| InChIKey | JDFAHOFOFNIFSB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |