C34H26N4O7 — CID 22010831
6-[[2-[methyl-[4-[[2-(4-nitrophenyl)benzoyl]amino]benzoyl]amino]phenoxy]methyl]pyridine-3-carboxylic acid (PubChem CID 22010831) has the molecular formula C34H26N4O7 and a molecular weight of 602.60 g/mol. Its IUPAC name is 6-[[2-[methyl-[4-[[2-(4-nitrophenyl)benzoyl]amino]benzoyl]amino]phenoxy]methyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[2-[methyl-[4-[[2-(4-nitrophenyl)benzoyl]amino]benzoyl]amino]phenoxy]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22010831 |
| Molecular Formula | C34H26N4O7 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 6-[[2-[methyl-[4-[[2-(4-nitrophenyl)benzoyl]amino]benzoyl]amino]phenoxy]methyl]pyridine-3-carboxylic acid |
| SMILES | CN(C(=O)c1ccc(NC(=O)c2ccccc2-c2ccc([N+](=O)[O-])cc2)cc1)c1ccccc1OCc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C34H26N4O7/c1-37(30-8-4-5-9-31(30)45-21-26-17-12-24(20-35-26)34(41)42)33(40)23-10-15-25(16-11-23)36-32(39)29-7-3-2-6-28(29)22-13-18-27(19-14-22)38(43)44/h2-20H,21H2,1H3,(H,36,39)(H,41,42) |
| InChIKey | VLJZLWSVGREKJZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|