C38H52N6O5 — CID 18791529
2-amino-4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-N-methylbenzamide (PubChem CID 18791529) has the molecular formula C38H52N6O5 and a molecular weight of 672.87 g/mol. Its IUPAC name is 2-amino-4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-N-methylbenzamide.
| Compound Name | 2-amino-4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18791529 |
| Molecular Formula | C38H52N6O5 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.40 |
| IUPAC Name | 2-amino-4-[[2-(3-aminopropoxy)benzoyl]amino]-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-N-methylbenzamide |
| SMILES | Cc1ccc(N(C)C(=O)c2ccc(NC(=O)c3ccccc3OCCCN)cc2N)c(OCCCCCC(=O)N2CCC(N(C)C)CC2)c1 |
| InChI | InChI=1S/C38H52N6O5/c1-27-14-17-33(35(25-27)49-23-9-5-6-13-36(45)44-21-18-29(19-22-44)42(2)3)43(4)38(47)30-16-15-28(26-32(30)40)41-37(46)31-11-7-8-12-34(31)48-24-10-20-39/h7-8,11-12,14-17,25-26,29H,5-6,9-10,13,18-24,39-40H2,1-4H3,(H,41,46) |
| InChIKey | QLQGPCXHMWWESU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|