C29H40N4O6 — CID 57164659
N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-4-(nitromethyl)benzamide (PubChem CID 57164659) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-4-(nitromethyl)benzamide.
| Compound Name | N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-4-(nitromethyl)benzamide |
|---|---|
| PubChem CID | 57164659 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]-3-methoxy-4-(nitromethyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C)cc2OCCCCCC(=O)N2CCC(N(C)C)CC2)ccc1C[N+](=O)[O-] |
| InChI | InChI=1S/C29H40N4O6/c1-21-9-12-25(30-29(35)22-10-11-23(20-33(36)37)26(19-22)38-4)27(18-21)39-17-7-5-6-8-28(34)32-15-13-24(14-16-32)31(2)3/h9-12,18-19,24H,5-8,13-17,20H2,1-4H3,(H,30,35) |
| InChIKey | GFGMTQOHEVLWSS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|