C25H41N3O4 — CID 18791280
tert-butyl N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]carbamate (PubChem CID 18791280) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is tert-butyl N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 18791280 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | tert-butyl N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OC(C)(C)C)c(OCCCCCC(=O)N2CCC(N(C)C)CC2)c1 |
| InChI | InChI=1S/C25H41N3O4/c1-19-11-12-21(26-24(30)32-25(2,3)4)22(18-19)31-17-9-7-8-10-23(29)28-15-13-20(14-16-28)27(5)6/h11-12,18,20H,7-10,13-17H2,1-6H3,(H,26,30) |
| InChIKey | AWDAXKRUVMNAMS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|