C28H32N6O2S — CID 87078415
N-(2-aminophenyl)-4-[[[6-[2-(4-methylpiperazin-1-yl)ethoxy]-1,3-benzothiazol-2-yl]amino]methyl]benzamide (PubChem CID 87078415) has the molecular formula C28H32N6O2S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[6-[2-(4-methylpiperazin-1-yl)ethoxy]-1,3-benzothiazol-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[6-[2-(4-methylpiperazin-1-yl)ethoxy]-1,3-benzothiazol-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 87078415 |
| Molecular Formula | C28H32N6O2S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[6-[2-(4-methylpiperazin-1-yl)ethoxy]-1,3-benzothiazol-2-yl]amino]methyl]benzamide |
| SMILES | CN1CCN(CCOc2ccc3nc(NCc4ccc(C(=O)Nc5ccccc5N)cc4)sc3c2)CC1 |
| InChI | InChI=1S/C28H32N6O2S/c1-33-12-14-34(15-13-33)16-17-36-22-10-11-25-26(18-22)37-28(32-25)30-19-20-6-8-21(9-7-20)27(35)31-24-5-3-2-4-23(24)29/h2-11,18H,12-17,19,29H2,1H3,(H,30,32)(H,31,35) |
| InChIKey | OVFMNUGBHDYRGU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|