C23H20N4OS — CID 85081146
N-(2-aminophenyl)-4-[3-(1,3-benzothiazol-2-ylamino)prop-1-enyl]benzamide (PubChem CID 85081146) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-(1,3-benzothiazol-2-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-(1,3-benzothiazol-2-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 85081146 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-(1,3-benzothiazol-2-ylamino)prop-1-enyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C=CCNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H20N4OS/c24-18-7-1-2-8-19(18)26-22(28)17-13-11-16(12-14-17)6-5-15-25-23-27-20-9-3-4-10-21(20)29-23/h1-14H,15,24H2,(H,25,27)(H,26,28) |
| InChIKey | BDMHGPVLVZENNV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|