C25H23N3O4 — CID 10094148
4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]prop-1-enyl]-N-(2-aminophenyl)benzamide (PubChem CID 10094148) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]prop-1-enyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]prop-1-enyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 10094148 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]prop-1-enyl]-N-(2-aminophenyl)benzamide |
| SMILES | CC(=O)c1cc2c(cc1NC/C=C/c1ccc(C(=O)Nc3ccccc3N)cc1)OCO2 |
| InChI | InChI=1S/C25H23N3O4/c1-16(29)19-13-23-24(32-15-31-23)14-22(19)27-12-4-5-17-8-10-18(11-9-17)25(30)28-21-7-3-2-6-20(21)26/h2-11,13-14,27H,12,15,26H2,1H3,(H,28,30)/b5-4+ |
| InChIKey | JDKRTKRVNTUYAL-SNAWJCMRSA-N |
| XLogP | 4.58 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|