C29H32N6O3S — CID 54761837
N-(2-aminophenyl)-4-[[[(2S)-2-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-4-methylpentanoyl]amino]methyl]benzamide (PubChem CID 54761837) has the molecular formula C29H32N6O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[(2S)-2-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-4-methylpentanoyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[(2S)-2-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-4-methylpentanoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 54761837 |
| Molecular Formula | C29H32N6O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[(2S)-2-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-4-methylpentanoyl]amino]methyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNc1nc2ccccc2s1)C(=O)NCc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C29H32N6O3S/c1-18(2)15-24(33-26(36)17-32-29-35-23-9-5-6-10-25(23)39-29)28(38)31-16-19-11-13-20(14-12-19)27(37)34-22-8-4-3-7-21(22)30/h3-14,18,24H,15-17,30H2,1-2H3,(H,31,38)(H,32,35)(H,33,36)(H,34,37)/t24-/m0/s1 |
| InChIKey | GFFKNJASNHHLLF-DEOSSOPVSA-N |
| XLogP | 4.39 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|