C21H26N4OS — CID 39826455
6-ethoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 39826455) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 6-ethoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-ethoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 39826455 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 6-ethoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc2nc(NCc3ccc(N4CCN(C)CC4)cc3)sc2c1 |
| InChI | InChI=1S/C21H26N4OS/c1-3-26-18-8-9-19-20(14-18)27-21(23-19)22-15-16-4-6-17(7-5-16)25-12-10-24(2)11-13-25/h4-9,14H,3,10-13,15H2,1-2H3,(H,22,23) |
| InChIKey | SPPAKOHOIYOMJO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|