C13H13N3O2S — CID 106419902
6-ethoxy-N-(1,2-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 106419902) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-ethoxy-N-(1,2-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-ethoxy-N-(1,2-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 106419902 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 6-ethoxy-N-(1,2-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc2nc(NCc3ccno3)sc2c1 |
| InChI | InChI=1S/C13H13N3O2S/c1-2-17-9-3-4-11-12(7-9)19-13(16-11)14-8-10-5-6-15-18-10/h3-7H,2,8H2,1H3,(H,14,16) |
| InChIKey | UCZNGENLIAHFMU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |