C26H22F3N3O4 — CID 68735071
N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-(trifluoromethyl)-1-benzofuran-2-carboxamide (PubChem CID 68735071) has the molecular formula C26H22F3N3O4 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-(trifluoromethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-(trifluoromethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68735071 |
| Molecular Formula | C26H22F3N3O4 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-(trifluoromethyl)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCCN(C(=O)c2cc3ccccc3o2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H22F3N3O4/c27-26(28,29)32(25(34)23-16-18-6-1-4-9-22(18)36-23)14-5-15-35-19-12-10-17(11-13-19)24(33)31-21-8-3-2-7-20(21)30/h1-4,6-13,16H,5,14-15,30H2,(H,31,33) |
| InChIKey | JMEZWFPJVAWCAB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|