C27H27N3O5 — CID 87554238
N-(2-aminophenyl)-4-[3-[formyl-[3-(methoxymethyl)-1-benzofuran-2-yl]amino]propoxy]benzamide (PubChem CID 87554238) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-[formyl-[3-(methoxymethyl)-1-benzofuran-2-yl]amino]propoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-[formyl-[3-(methoxymethyl)-1-benzofuran-2-yl]amino]propoxy]benzamide |
|---|---|
| PubChem CID | 87554238 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-[formyl-[3-(methoxymethyl)-1-benzofuran-2-yl]amino]propoxy]benzamide |
| SMILES | COCc1c(N(C=O)CCCOc2ccc(C(=O)Nc3ccccc3N)cc2)oc2ccccc12 |
| InChI | InChI=1S/C27H27N3O5/c1-33-17-22-21-7-2-5-10-25(21)35-27(22)30(18-31)15-6-16-34-20-13-11-19(12-14-20)26(32)29-24-9-4-3-8-23(24)28/h2-5,7-14,18H,6,15-17,28H2,1H3,(H,29,32) |
| InChIKey | XFWGBNGWAGQWQI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|