C30H32N4O6 — CID 87554069
N-(2-aminophenyl)-4-[2-[formyl-[3-(2-morpholin-2-ylethoxy)-1-benzofuran-2-yl]amino]ethoxy]benzamide (PubChem CID 87554069) has the molecular formula C30H32N4O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[formyl-[3-(2-morpholin-2-ylethoxy)-1-benzofuran-2-yl]amino]ethoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[formyl-[3-(2-morpholin-2-ylethoxy)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87554069 |
| Molecular Formula | C30H32N4O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[formyl-[3-(2-morpholin-2-ylethoxy)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCN(C=O)c2oc3ccccc3c2OCCC2CNCCO2)cc1 |
| InChI | InChI=1S/C30H32N4O6/c31-25-6-2-3-7-26(25)33-29(36)21-9-11-22(12-10-21)38-18-15-34(20-35)30-28(24-5-1-4-8-27(24)40-30)39-16-13-23-19-32-14-17-37-23/h1-12,20,23,32H,13-19,31H2,(H,33,36) |
| InChIKey | DKNORAWJATVCSW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|