C28H24N6O4 — CID 87554276
N-(2-aminophenyl)-4-[2-[formyl-[3-(1,3,5-triazin-2-ylmethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide (PubChem CID 87554276) has the molecular formula C28H24N6O4 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[formyl-[3-(1,3,5-triazin-2-ylmethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[formyl-[3-(1,3,5-triazin-2-ylmethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87554276 |
| Molecular Formula | C28H24N6O4 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[formyl-[3-(1,3,5-triazin-2-ylmethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCN(C=O)c2oc3ccccc3c2Cc2ncncn2)cc1 |
| InChI | InChI=1S/C28H24N6O4/c29-23-6-2-3-7-24(23)33-27(36)19-9-11-20(12-10-19)37-14-13-34(18-35)28-22(15-26-31-16-30-17-32-26)21-5-1-4-8-25(21)38-28/h1-12,16-18H,13-15,29H2,(H,33,36) |
| InChIKey | JYABHMOLNFUNNH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|