C32H29N3O4 — CID 87554590
N-(2-aminophenyl)-4-[2-[formyl-[4-(2-phenylethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide (PubChem CID 87554590) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[formyl-[4-(2-phenylethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[formyl-[4-(2-phenylethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87554590 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[formyl-[4-(2-phenylethyl)-1-benzofuran-2-yl]amino]ethoxy]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCN(C=O)c2cc3c(CCc4ccccc4)cccc3o2)cc1 |
| InChI | InChI=1S/C32H29N3O4/c33-28-10-4-5-11-29(28)34-32(37)25-15-17-26(18-16-25)38-20-19-35(22-36)31-21-27-24(9-6-12-30(27)39-31)14-13-23-7-2-1-3-8-23/h1-12,15-18,21-22H,13-14,19-20,33H2,(H,34,37) |
| InChIKey | GPHXSYHVZWDPKO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|