C32H30N4O4 — CID 87554535
N-(2-aminophenyl)-4-[2-[[5-[(benzylamino)methyl]-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide (PubChem CID 87554535) has the molecular formula C32H30N4O4 and a molecular weight of 534.62 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[[5-[(benzylamino)methyl]-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[[5-[(benzylamino)methyl]-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87554535 |
| Molecular Formula | C32H30N4O4 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[[5-[(benzylamino)methyl]-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCN(C=O)c2cc3cc(CNCc4ccccc4)ccc3o2)cc1 |
| InChI | InChI=1S/C32H30N4O4/c33-28-8-4-5-9-29(28)35-32(38)25-11-13-27(14-12-25)39-17-16-36(22-37)31-19-26-18-24(10-15-30(26)40-31)21-34-20-23-6-2-1-3-7-23/h1-15,18-19,22,34H,16-17,20-21,33H2,(H,35,38) |
| InChIKey | RLNHZGNHCLRLDQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|