C31H26FN3O5 — CID 68771472
N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-7-fluoro-N-(phenoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 68771472) has the molecular formula C31H26FN3O5 and a molecular weight of 539.56 g/mol. Its IUPAC name is N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-7-fluoro-N-(phenoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-7-fluoro-N-(phenoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68771472 |
| Molecular Formula | C31H26FN3O5 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-7-fluoro-N-(phenoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCN(COc2ccccc2)C(=O)c2cc3cccc(F)c3o2)cc1 |
| InChI | InChI=1S/C31H26FN3O5/c32-25-10-6-7-22-19-28(40-29(22)25)31(37)35(20-39-23-8-2-1-3-9-23)17-18-38-24-15-13-21(14-16-24)30(36)34-27-12-5-4-11-26(27)33/h1-16,19H,17-18,20,33H2,(H,34,36) |
| InChIKey | ZAMKPKXHJVUQQC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|