C26H22F3N3O5 — CID 68733776
N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-6-(trifluoromethoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 68733776) has the molecular formula C26H22F3N3O5 and a molecular weight of 513.47 g/mol. Its IUPAC name is N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-6-(trifluoromethoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-6-(trifluoromethoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68733776 |
| Molecular Formula | C26H22F3N3O5 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-6-(trifluoromethoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCNC(=O)c2cc3ccc(COC(F)(F)F)cc3o2)cc1 |
| InChI | InChI=1S/C26H22F3N3O5/c27-26(28,29)36-15-16-5-6-18-14-23(37-22(18)13-16)25(34)31-11-12-35-19-9-7-17(8-10-19)24(33)32-21-4-2-1-3-20(21)30/h1-10,13-14H,11-12,15,30H2,(H,31,34)(H,32,33) |
| InChIKey | LJMMKSMNXUOYMR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|