C29H31N3O5 — CID 140557054
N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(2-propoxyethyl)-1-benzofuran-2-carboxamide (PubChem CID 140557054) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(2-propoxyethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(2-propoxyethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 140557054 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(2-propoxyethyl)-1-benzofuran-2-carboxamide |
| SMILES | CCCOCCc1ccc2oc(C(=O)NCCOc3ccc(C(=O)Nc4ccccc4N)cc3)cc2c1 |
| InChI | InChI=1S/C29H31N3O5/c1-2-15-35-16-13-20-7-12-26-22(18-20)19-27(37-26)29(34)31-14-17-36-23-10-8-21(9-11-23)28(33)32-25-6-4-3-5-24(25)30/h3-12,18-19H,2,13-17,30H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | STIRTPOFFODYOD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|