C28H24N6O4 — CID 68736080
N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-4-(triazin-4-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 68736080) has the molecular formula C28H24N6O4 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-4-(triazin-4-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-4-(triazin-4-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68736080 |
| Molecular Formula | C28H24N6O4 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-4-(triazin-4-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCNC(=O)c2cc3c(Cc4ccnnn4)cccc3o2)cc1 |
| InChI | InChI=1S/C28H24N6O4/c29-23-5-1-2-6-24(23)32-27(35)18-8-10-21(11-9-18)37-15-14-30-28(36)26-17-22-19(4-3-7-25(22)38-26)16-20-12-13-31-34-33-20/h1-13,17H,14-16,29H2,(H,30,36)(H,32,35) |
| InChIKey | AHQKVVNYMGHXGI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|