C24H20N2O6 — CID 87894461
4-hydroxy-N-[2-[4-[hydroxy(phenyl)carbamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 87894461) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[4-[hydroxy(phenyl)carbamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 4-hydroxy-N-[2-[4-[hydroxy(phenyl)carbamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87894461 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-hydroxy-N-[2-[4-[hydroxy(phenyl)carbamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(=O)N(O)c2ccccc2)cc1)c1cc2c(O)cccc2o1 |
| InChI | InChI=1S/C24H20N2O6/c27-20-7-4-8-21-19(20)15-22(32-21)23(28)25-13-14-31-18-11-9-16(10-12-18)24(29)26(30)17-5-2-1-3-6-17/h1-12,15,27,30H,13-14H2,(H,25,28) |
| InChIKey | WJIBZWPPVYMCRU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|