C28H29N3O5 — CID 87554542
N-(2-aminophenyl)-4-[2-[[4-(2-ethoxyethyl)-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide (PubChem CID 87554542) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[[4-(2-ethoxyethyl)-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[[4-(2-ethoxyethyl)-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide |
|---|---|
| PubChem CID | 87554542 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[[4-(2-ethoxyethyl)-1-benzofuran-2-yl]-formylamino]ethoxy]benzamide |
| SMILES | CCOCCc1cccc2oc(N(C=O)CCOc3ccc(C(=O)Nc4ccccc4N)cc3)cc12 |
| InChI | InChI=1S/C28H29N3O5/c1-2-34-16-14-20-6-5-9-26-23(20)18-27(36-26)31(19-32)15-17-35-22-12-10-21(11-13-22)28(33)30-25-8-4-3-7-24(25)29/h3-13,18-19H,2,14-17,29H2,1H3,(H,30,33) |
| InChIKey | MUZYKUBDCQLBEB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|