C32H29N3O5 — CID 68734084
N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-[(2-hydroxyphenyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 68734084) has the molecular formula C32H29N3O5 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-[(2-hydroxyphenyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-[(2-hydroxyphenyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68734084 |
| Molecular Formula | C32H29N3O5 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N-[3-[4-[(2-aminophenyl)carbamoyl]phenoxy]propyl]-N-[(2-hydroxyphenyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCCN(Cc2ccccc2O)C(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C32H29N3O5/c33-26-10-3-4-11-27(26)34-31(37)22-14-16-25(17-15-22)39-19-7-18-35(21-24-9-1-5-12-28(24)36)32(38)30-20-23-8-2-6-13-29(23)40-30/h1-6,8-17,20,36H,7,18-19,21,33H2,(H,34,37) |
| InChIKey | PQDCPZNUQNCGIZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|