C29H30N4O5 — CID 68734155
N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(morpholin-2-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 68734155) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(morpholin-2-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(morpholin-2-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 68734155 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl]-5-(morpholin-2-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(OCCNC(=O)c2cc3cc(CC4CNCCO4)ccc3o2)cc1 |
| InChI | InChI=1S/C29H30N4O5/c30-24-3-1-2-4-25(24)33-28(34)20-6-8-22(9-7-20)36-14-12-32-29(35)27-17-21-15-19(5-10-26(21)38-27)16-23-18-31-11-13-37-23/h1-10,15,17,23,31H,11-14,16,18,30H2,(H,32,35)(H,33,34) |
| InChIKey | LDVLJTIHAMVRMY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|