C23H25N3O5S — CID 87642245
N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-5-piperidin-4-yloxy-1-benzofuran-2-carboxamide (PubChem CID 87642245) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-5-piperidin-4-yloxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-5-piperidin-4-yloxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87642245 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-5-piperidin-4-yloxy-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(=S)NO)cc1)c1cc2cc(OC3CCNCC3)ccc2o1 |
| InChI | InChI=1S/C23H25N3O5S/c27-22(25-11-12-29-17-3-1-15(2-4-17)23(32)26-28)21-14-16-13-19(5-6-20(16)31-21)30-18-7-9-24-10-8-18/h1-6,13-14,18,24,28H,7-12H2,(H,25,27)(H,26,32) |
| InChIKey | FURYSVZFNZGMIG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|