C24H26N2O6S — CID 87640577
N-[(2R)-2-[4-(hydroxycarbamothioyl)phenoxy]propyl]-5-(oxan-4-yloxy)-1-benzofuran-2-carboxamide (PubChem CID 87640577) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[(2R)-2-[4-(hydroxycarbamothioyl)phenoxy]propyl]-5-(oxan-4-yloxy)-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2R)-2-[4-(hydroxycarbamothioyl)phenoxy]propyl]-5-(oxan-4-yloxy)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87640577 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[(2R)-2-[4-(hydroxycarbamothioyl)phenoxy]propyl]-5-(oxan-4-yloxy)-1-benzofuran-2-carboxamide |
| SMILES | C[C@H](CNC(=O)c1cc2cc(OC3CCOCC3)ccc2o1)Oc1ccc(C(=S)NO)cc1 |
| InChI | InChI=1S/C24H26N2O6S/c1-15(30-18-4-2-16(3-5-18)24(33)26-28)14-25-23(27)22-13-17-12-20(6-7-21(17)32-22)31-19-8-10-29-11-9-19/h2-7,12-13,15,19,28H,8-11,14H2,1H3,(H,25,27)(H,26,33)/t15-/m1/s1 |
| InChIKey | WPVHSFOZDDNMGH-OAHLLOKOSA-N |
| XLogP | 3.84 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|