C23H22N2O6S — CID 91404659
N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-4-(5-methoxy-1-benzofuran-2-yl)-2-oxopent-3-enamide (PubChem CID 91404659) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-4-(5-methoxy-1-benzofuran-2-yl)-2-oxopent-3-enamide.
| Compound Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-4-(5-methoxy-1-benzofuran-2-yl)-2-oxopent-3-enamide |
|---|---|
| PubChem CID | 91404659 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-4-(5-methoxy-1-benzofuran-2-yl)-2-oxopent-3-enamide |
| SMILES | COc1ccc2oc(C(C)=CC(=O)C(=O)NCCOc3ccc(C(=S)NO)cc3)cc2c1 |
| InChI | InChI=1S/C23H22N2O6S/c1-14(21-13-16-12-18(29-2)7-8-20(16)31-21)11-19(26)22(27)24-9-10-30-17-5-3-15(4-6-17)23(32)25-28/h3-8,11-13,28H,9-10H2,1-2H3,(H,24,27)(H,25,32) |
| InChIKey | WODZWFRVXVDVBI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|