C18H16N2O3S2 — CID 87641192
N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 87641192) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 87641192 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(=S)NO)cc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H16N2O3S2/c21-17(16-11-13-3-1-2-4-15(13)25-16)19-9-10-23-14-7-5-12(6-8-14)18(24)20-22/h1-8,11,22H,9-10H2,(H,19,21)(H,20,24) |
| InChIKey | DYWNPSGPFIQYBS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|