C17H16N4O3S — CID 87641499
N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 87641499) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 87641499 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[2-[4-(hydroxycarbamothioyl)phenoxy]ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(=S)NO)cc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C17H16N4O3S/c22-16(12-3-6-14-15(9-12)20-10-19-14)18-7-8-24-13-4-1-11(2-5-13)17(25)21-23/h1-6,9-10,23H,7-8H2,(H,18,22)(H,19,20)(H,21,25) |
| InChIKey | SZHUVPWSVHQBTN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|