C30H34N5O4+ — CID 87554620
2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl-(1-benzofuran-2-yl)-formyl-[(4-methylpiperazin-1-yl)methyl]azanium (PubChem CID 87554620) has the molecular formula C30H34N5O4+ and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl-(1-benzofuran-2-yl)-formyl-[(4-methylpiperazin-1-yl)methyl]azanium.
| Compound Name | 2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl-(1-benzofuran-2-yl)-formyl-[(4-methylpiperazin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 87554620 |
| Molecular Formula | C30H34N5O4+ |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethyl-(1-benzofuran-2-yl)-formyl-[(4-methylpiperazin-1-yl)methyl]azanium |
| SMILES | CN1CCN(C[N+](C=O)(CCOc2ccc(C(=O)Nc3ccccc3N)cc2)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C30H33N5O4/c1-33-14-16-34(17-15-33)21-35(22-36,29-20-24-6-2-5-9-28(24)39-29)18-19-38-25-12-10-23(11-13-25)30(37)32-27-8-4-3-7-26(27)31/h2-13,20,22H,14-19,21,31H2,1H3/p+1 |
| InChIKey | SRIHMFUMMDHTGW-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|