C19H16N2O4 — CID 20856926
N-[2-(3-acetylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide (PubChem CID 20856926) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[2-(3-acetylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(3-acetylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 20856926 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[2-(3-acetylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)CNC(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C19H16N2O4/c1-12(22)13-6-4-7-15(9-13)21-18(23)11-20-19(24)17-10-14-5-2-3-8-16(14)25-17/h2-10H,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | SZHGGXPAEGWDFE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |