C17H14ClNO2S — CID 11616917
5-chloro-N-[(2-methylsulfanylphenyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 11616917) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is 5-chloro-N-[(2-methylsulfanylphenyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(2-methylsulfanylphenyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11616917 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-chloro-N-[(2-methylsulfanylphenyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | CSc1ccccc1CNC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H14ClNO2S/c1-22-16-5-3-2-4-11(16)10-19-17(20)15-9-12-8-13(18)6-7-14(12)21-15/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | ACSQYOOGOQNDFU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |