C12H16BrNO4 — CID 119361264
(2S)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119361264) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361264 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (2S)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1cc(Br)oc1C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H16BrNO4/c1-6(2)4-8(12(16)17)14-11(15)10-7(3)5-9(13)18-10/h5-6,8H,4H2,1-3H3,(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | MQYACWNSNDFDRU-QMMMGPOBSA-N |
| XLogP | 2.58 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |