C9H10BrNO4 — CID 103791126
(2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 103791126) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103791126 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1cc(Br)oc1C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C9H10BrNO4/c1-4-3-6(10)15-7(4)8(12)11-5(2)9(13)14/h3,5H,1-2H3,(H,11,12)(H,13,14)/t5-/m1/s1 |
| InChIKey | PJSNYGLYHROTOC-RXMQYKEDSA-N |
| XLogP | 1.55 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |