C14H14BrNO3 — CID 110922851
5-bromo-N-[4-(2-hydroxyethyl)phenyl]-3-methylfuran-2-carboxamide (PubChem CID 110922851) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-bromo-N-[4-(2-hydroxyethyl)phenyl]-3-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(2-hydroxyethyl)phenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 110922851 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5-bromo-N-[4-(2-hydroxyethyl)phenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1cc(Br)oc1C(=O)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C14H14BrNO3/c1-9-8-12(15)19-13(9)14(18)16-11-4-2-10(3-5-11)6-7-17/h2-5,8,17H,6-7H2,1H3,(H,16,18) |
| InChIKey | OGDZTFFMHXNKDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |